C19H25NO2S — CID 24685614
1-(4-methylsulfonylphenyl)-N-[(4-propan-2-ylphenyl)methyl]ethanamine (PubChem CID 24685614) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-N-[(4-propan-2-ylphenyl)methyl]ethanamine.
| Compound Name | 1-(4-methylsulfonylphenyl)-N-[(4-propan-2-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 24685614 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-N-[(4-propan-2-ylphenyl)methyl]ethanamine |
| SMILES | CC(C)c1ccc(CNC(C)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H25NO2S/c1-14(2)17-7-5-16(6-8-17)13-20-15(3)18-9-11-19(12-10-18)23(4,21)22/h5-12,14-15,20H,13H2,1-4H3 |
| InChIKey | ZCUWFBKAIQGOHJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |