C22H29NO2S — CID 24900020
(2R)-2-methyl-1-[2-[4-(4-propylsulfonylphenyl)phenyl]ethyl]pyrrolidine (PubChem CID 24900020) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is (2R)-2-methyl-1-[2-[4-(4-propylsulfonylphenyl)phenyl]ethyl]pyrrolidine.
| Compound Name | (2R)-2-methyl-1-[2-[4-(4-propylsulfonylphenyl)phenyl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 24900020 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2R)-2-methyl-1-[2-[4-(4-propylsulfonylphenyl)phenyl]ethyl]pyrrolidine |
| SMILES | CCCS(=O)(=O)c1ccc(-c2ccc(CCN3CCC[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C22H29NO2S/c1-3-17-26(24,25)22-12-10-21(11-13-22)20-8-6-19(7-9-20)14-16-23-15-4-5-18(23)2/h6-13,18H,3-5,14-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | LVYVZXUCWPOALM-GOSISDBHSA-N |
| XLogP | 4.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |