C24H31NO2S — CID 24897021
(2R)-1-[2-[4-(4-cyclopentylsulfonylphenyl)phenyl]ethyl]-2-methylpyrrolidine (PubChem CID 24897021) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is (2R)-1-[2-[4-(4-cyclopentylsulfonylphenyl)phenyl]ethyl]-2-methylpyrrolidine.
| Compound Name | (2R)-1-[2-[4-(4-cyclopentylsulfonylphenyl)phenyl]ethyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 24897021 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2R)-1-[2-[4-(4-cyclopentylsulfonylphenyl)phenyl]ethyl]-2-methylpyrrolidine |
| SMILES | C[C@@H]1CCCN1CCc1ccc(-c2ccc(S(=O)(=O)C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H31NO2S/c1-19-5-4-17-25(19)18-16-20-8-10-21(11-9-20)22-12-14-24(15-13-22)28(26,27)23-6-2-3-7-23/h8-15,19,23H,2-7,16-18H2,1H3/t19-/m1/s1 |
| InChIKey | DOLUVTOFQXUGGU-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |