C23H31NO3S — CID 24900263
(2R)-1-[2-[4-[4-(2-ethoxyethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine (PubChem CID 24900263) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is (2R)-1-[2-[4-[4-(2-ethoxyethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine.
| Compound Name | (2R)-1-[2-[4-[4-(2-ethoxyethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 24900263 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (2R)-1-[2-[4-[4-(2-ethoxyethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
| SMILES | CCOCCS(=O)(=O)c1ccc(-c2ccc(CCN3CCC[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C23H31NO3S/c1-3-27-17-18-28(25,26)23-12-10-22(11-13-23)21-8-6-20(7-9-21)14-16-24-15-4-5-19(24)2/h6-13,19H,3-5,14-18H2,1-2H3/t19-/m1/s1 |
| InChIKey | YMRMKCOJONCFSM-LJQANCHMSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|