C22H23N3O4S — CID 24686062
3-acetamido-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenylpropanamide (PubChem CID 24686062) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-acetamido-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenylpropanamide.
| Compound Name | 3-acetamido-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 24686062 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 3-acetamido-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenylpropanamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CC(NC(C)=O)c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C22H23N3O4S/c1-14(26)23-17(15-7-5-4-6-8-15)12-21(27)25-22-24-18(13-30-22)16-9-10-19(28-2)20(11-16)29-3/h4-11,13,17H,12H2,1-3H3,(H,23,26)(H,24,25,27) |
| InChIKey | RAXNUBGUMFGMSY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |