C26H30N6O3S — CID 24686870
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-4-(1H-benzimidazol-2-ylsulfanyl)-N-butylbutanamide (PubChem CID 24686870) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-4-(1H-benzimidazol-2-ylsulfanyl)-N-butylbutanamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-4-(1H-benzimidazol-2-ylsulfanyl)-N-butylbutanamide |
|---|---|
| PubChem CID | 24686870 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-4-(1H-benzimidazol-2-ylsulfanyl)-N-butylbutanamide |
| SMILES | CCCCN(C(=O)CCCSc1nc2ccccc2[nH]1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H30N6O3S/c1-2-3-15-31(21(33)14-9-16-36-25-28-19-12-7-8-13-20(19)29-25)22-23(27)32(26(35)30-24(22)34)17-18-10-5-4-6-11-18/h4-8,10-13H,2-3,9,14-17,27H2,1H3,(H,28,29)(H,30,34,35) |
| InChIKey | DPTFUQWVSWJMGN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|