About methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate
methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate (PubChem CID 2468748) has the molecular formula C29H27N3O3
and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate |
| PubChem CID | 2468748 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2c3c(nc4ccccc24)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C29H27N3O3/c1-35-29(34)22-13-11-20(12-14-22)17-30-28(33)27-23-9-5-6-10-25(23)31-26-15-16-32(19-24(26)27)18-21-7-3-2-4-8-21/h2-14H,15-19H2,1H3,(H,30,33) |
| InChIKey | ONERTNYDCLDHHG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate?
The IUPAC name of methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate (CID 2468748) is methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate.
What is the SMILES notation for methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate?
The canonical SMILES for methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate is COC(=O)c1ccc(CNC(=O)c2c3c(nc4ccccc24)CCN(Cc2ccccc2)C3)cc1.
What is the InChIKey of methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate?
The InChIKey is ONERTNYDCLDHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N3O3/c1-35-29(34)22-13-11-20(12-14-22)17-30-28(33)27-23-9-5-6-10-25(23)31-26-15-16-32(19-24(26)27)18-21-7-3-2-4-8-21/h2-14H,15-19H2,1H3,(H,30,33).
What are the key properties of methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate?
methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate has a molecular weight of 465.55 g/mol, XLogP of 4.51, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbonyl)amino]methyl]benzoate is sourced from PubChem (CID 2468748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).