C15H18N2O6S — CID 24687812
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 24687812) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 24687812 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc([N+](=O)[O-])cc1)NCC1CCCO1 |
| InChI | InChI=1S/C15H18N2O6S/c18-14(16-8-12-2-1-7-22-12)9-23-15(19)10-24-13-5-3-11(4-6-13)17(20)21/h3-6,12H,1-2,7-10H2,(H,16,18) |
| InChIKey | YOAYHUHLFNEGFU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|