C18H24N2O5S — CID 24979654
[2-(cyclooctylamino)-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 24979654) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 24979654 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc([N+](=O)[O-])cc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C18H24N2O5S/c21-17(19-14-6-4-2-1-3-5-7-14)12-25-18(22)13-26-16-10-8-15(9-11-16)20(23)24/h8-11,14H,1-7,12-13H2,(H,19,21) |
| InChIKey | XATJOEULULAYEB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|