C23H15N3O4 — CID 2469170
N'-(1-benzofuran-2-carbonyl)-2-(furan-2-yl)quinoline-4-carbohydrazide (PubChem CID 2469170) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is N'-(1-benzofuran-2-carbonyl)-2-(furan-2-yl)quinoline-4-carbohydrazide.
| Compound Name | N'-(1-benzofuran-2-carbonyl)-2-(furan-2-yl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 2469170 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N'-(1-benzofuran-2-carbonyl)-2-(furan-2-yl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccco2)nc2ccccc12)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H15N3O4/c27-22(25-26-23(28)21-12-14-6-1-4-9-19(14)30-21)16-13-18(20-10-5-11-29-20)24-17-8-3-2-7-15(16)17/h1-13H,(H,25,27)(H,26,28) |
| InChIKey | SBQFKHJHFWKDEC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|