C26H18N4O4 — CID 55789537
2-(furan-2-yl)-N'-(2-oxo-6-phenyl-1H-pyridine-3-carbonyl)quinoline-4-carbohydrazide (PubChem CID 55789537) has the molecular formula C26H18N4O4 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-(2-oxo-6-phenyl-1H-pyridine-3-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-(2-oxo-6-phenyl-1H-pyridine-3-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55789537 |
| Molecular Formula | C26H18N4O4 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-(furan-2-yl)-N'-(2-oxo-6-phenyl-1H-pyridine-3-carbonyl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccco2)nc2ccccc12)c1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C26H18N4O4/c31-24-18(12-13-20(28-24)16-7-2-1-3-8-16)25(32)29-30-26(33)19-15-22(23-11-6-14-34-23)27-21-10-5-4-9-17(19)21/h1-15H,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | MTMMPBHPFGGVCK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|