C24H19N5O4 — CID 134051137
2-(furan-2-yl)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]quinoline-4-carbohydrazide (PubChem CID 134051137) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 134051137 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-(furan-2-yl)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]quinoline-4-carbohydrazide |
| SMILES | Cn1c(=O)n(CC(=O)NNC(=O)c2cc(-c3ccco3)nc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C24H19N5O4/c1-28-19-9-4-5-10-20(19)29(24(28)32)14-22(30)26-27-23(31)16-13-18(21-11-6-12-33-21)25-17-8-3-2-7-15(16)17/h2-13H,14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | YGRXBKOVJHJVQX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|