C23H23N3O3 — CID 6598868
N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(furan-2-yl)quinoline-4-carbohydrazide (PubChem CID 6598868) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(furan-2-yl)quinoline-4-carbohydrazide.
| Compound Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(furan-2-yl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 6598868 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-2-(furan-2-yl)quinoline-4-carbohydrazide |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C23H23N3O3/c27-22(12-16-11-14-7-8-15(16)10-14)25-26-23(28)18-13-20(21-6-3-9-29-21)24-19-5-2-1-4-17(18)19/h1-6,9,13-16H,7-8,10-12H2,(H,25,27)(H,26,28)/t14-,15+,16+/m0/s1 |
| InChIKey | LMXDCVDHUYPWPO-ARFHVFGLSA-N |
| XLogP | 4.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|