C26H26N3O2+ — CID 2425720
N-(1-benzylpiperidin-1-ium-4-yl)-2-(furan-2-yl)quinoline-4-carboxamide (PubChem CID 2425720) has the molecular formula C26H26N3O2+ and a molecular weight of 412.51 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-2-(furan-2-yl)quinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(furan-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2425720 |
| Molecular Formula | C26H26N3O2+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(furan-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(NC1CC[NH+](Cc2ccccc2)CC1)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C26H25N3O2/c30-26(27-20-12-14-29(15-13-20)18-19-7-2-1-3-8-19)22-17-24(25-11-6-16-31-25)28-23-10-5-4-9-21(22)23/h1-11,16-17,20H,12-15,18H2,(H,27,30)/p+1 |
| InChIKey | PQNVUDUSSGTITE-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |