C22H24N4O2S — CID 8742136
1-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]-3-[(1S,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8742136) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]-3-[(1S,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8742136 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)NNC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C22H24N4O2S/c1-14-7-2-4-9-17(14)24-22(29)26-25-21(27)16-13-19(20-11-6-12-28-20)23-18-10-5-3-8-15(16)18/h3,5-6,8,10-14,17H,2,4,7,9H2,1H3,(H,25,27)(H2,24,26,29)/t14-,17-/m0/s1 |
| InChIKey | AFEDULXAEXELJN-YOEHRIQHSA-N |
| XLogP | 4.18 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|