C23H26N4O5S — CID 55913391
2-(furan-2-yl)-N'-(1-propylsulfonylpiperidine-3-carbonyl)quinoline-4-carbohydrazide (PubChem CID 55913391) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-(1-propylsulfonylpiperidine-3-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-(1-propylsulfonylpiperidine-3-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55913391 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-(furan-2-yl)-N'-(1-propylsulfonylpiperidine-3-carbonyl)quinoline-4-carbohydrazide |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)NNC(=O)c2cc(-c3ccco3)nc3ccccc23)C1 |
| InChI | InChI=1S/C23H26N4O5S/c1-2-13-33(30,31)27-11-5-7-16(15-27)22(28)25-26-23(29)18-14-20(21-10-6-12-32-21)24-19-9-4-3-8-17(18)19/h3-4,6,8-10,12,14,16H,2,5,7,11,13,15H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | HFOLWERAXVNTDC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|