C22H20F3N3O3 — CID 55789686
2-(furan-2-yl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]quinoline-4-carbohydrazide (PubChem CID 55789686) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55789686 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-(furan-2-yl)-N'-[3-(trifluoromethyl)cyclohexanecarbonyl]quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCC(C(F)(F)F)C1)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)14-6-3-5-13(11-14)20(29)27-28-21(30)16-12-18(19-9-4-10-31-19)26-17-8-2-1-7-15(16)17/h1-2,4,7-10,12-14H,3,5-6,11H2,(H,27,29)(H,28,30) |
| InChIKey | XGTDIJJFAZUAST-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|