C23H21N5O4S2 — CID 42992799
1-[3-(dimethylsulfamoyl)phenyl]-3-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]thiourea (PubChem CID 42992799) has the molecular formula C23H21N5O4S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 42992799 |
| Molecular Formula | C23H21N5O4S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NNC(=O)c2cc(-c3ccco3)nc3ccccc23)c1 |
| InChI | InChI=1S/C23H21N5O4S2/c1-28(2)34(30,31)16-8-5-7-15(13-16)24-23(33)27-26-22(29)18-14-20(21-11-6-12-32-21)25-19-10-4-3-9-17(18)19/h3-14H,1-2H3,(H,26,29)(H2,24,27,33) |
| InChIKey | AFGNGBBCJNVPCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|