C24H22N6O4S2 — CID 4854176
1-[3-(dimethylsulfamoyl)phenyl]-3-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiourea (PubChem CID 4854176) has the molecular formula C24H22N6O4S2 and a molecular weight of 522.61 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 4854176 |
| Molecular Formula | C24H22N6O4S2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NNC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C24H22N6O4S2/c1-29(2)36(33,34)18-12-8-9-16(15-18)25-24(35)27-26-22(31)21-19-13-6-7-14-20(19)23(32)30(28-21)17-10-4-3-5-11-17/h3-15H,1-2H3,(H,26,31)(H2,25,27,35) |
| InChIKey | XJMWNUGCWBOACU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|