C21H16N4O4S — CID 4020636
4-oxo-3-phenyl-N-(3-sulfamoylphenyl)phthalazine-1-carboxamide (PubChem CID 4020636) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-oxo-3-phenyl-N-(3-sulfamoylphenyl)phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-phenyl-N-(3-sulfamoylphenyl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4020636 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-oxo-3-phenyl-N-(3-sulfamoylphenyl)phthalazine-1-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C21H16N4O4S/c22-30(28,29)16-10-6-7-14(13-16)23-20(26)19-17-11-4-5-12-18(17)21(27)25(24-19)15-8-2-1-3-9-15/h1-13H,(H,23,26)(H2,22,28,29) |
| InChIKey | YFXZDHZOGUEHAI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |