C24H22N4O4S — CID 5197386
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 5197386) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 5197386 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C24H22N4O4S/c1-16-13-14-17(15-21(16)33(31,32)27(2)3)25-23(29)22-19-11-7-8-12-20(19)24(30)28(26-22)18-9-5-4-6-10-18/h4-15H,1-3H3,(H,25,29) |
| InChIKey | QIESSAWDJKKFPI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |