C27H22N4O4 — CID 55495177
2-(furan-2-yl)-N'-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoyl]quinoline-4-carbohydrazide (PubChem CID 55495177) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55495177 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-(furan-2-yl)-N'-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoyl]quinoline-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cnc(CCC(=O)NNC(=O)c3cc(-c4ccco4)nc4ccccc34)o2)cc1 |
| InChI | InChI=1S/C27H22N4O4/c1-17-8-10-18(11-9-17)24-16-28-26(35-24)13-12-25(32)30-31-27(33)20-15-22(23-7-4-14-34-23)29-21-6-3-2-5-19(20)21/h2-11,14-16H,12-13H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | DNEXVZJGWLBXKZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|