C8H9N3O5 — CID 24691931
2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]propanoic acid (PubChem CID 24691931) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 24691931 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C8H9N3O5/c1-3(7(14)15)9-6(13)4-2-5(12)11-8(16)10-4/h2-3H,1H3,(H,9,13)(H,14,15)(H2,10,11,12,16) |
| InChIKey | CPNJTGUXQYSDQX-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |