C17H19N3 — CID 24695357
2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]benzenecarboximidamide (PubChem CID 24695357) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]benzenecarboximidamide.
| Compound Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 24695357 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1CN1c2ccccc2CC1C |
| InChI | InChI=1S/C17H19N3/c1-12-10-13-6-3-5-9-16(13)20(12)11-14-7-2-4-8-15(14)17(18)19/h2-9,12H,10-11H2,1H3,(H3,18,19) |
| InChIKey | DOVQNCKQQGSKMQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|