C11H13N3O5 — CID 24696646
1-(2,4-dioxo-1H-pyrimidine-6-carbonyl)piperidine-3-carboxylic acid (PubChem CID 24696646) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-(2,4-dioxo-1H-pyrimidine-6-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(2,4-dioxo-1H-pyrimidine-6-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 24696646 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(2,4-dioxo-1H-pyrimidine-6-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)C1 |
| InChI | InChI=1S/C11H13N3O5/c15-8-4-7(12-11(19)13-8)9(16)14-3-1-2-6(5-14)10(17)18/h4,6H,1-3,5H2,(H,17,18)(H2,12,13,15,19) |
| InChIKey | CEYLLUZPOCAGPL-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |