1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid

C9H7N3O4 — CID 24697601

IUPAC1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid
SMILESCn1c(=O)[nH]c(=O)c2ccc(C(=O)O)nc21
InChIInChI=1S/C9H7N3O4/c1-12-6-4(7(13)11-9(12)16)2-3-5(10-6)8(14)15/h2-3H,1H3,(H,14,15)(H,11,13,16)
InChIKeyCAOKZFGLLFQDNW-UHFFFAOYSA-N
MW221.17 g/mol
LogP-0.68
Rot. Bonds1

About 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid

1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid (PubChem CID 24697601) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid.

Molecular Properties

Compound Name1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid
PubChem CID24697601
Molecular FormulaC9H7N3O4
Molecular Weight221.17 g/mol
Exact Mass221.04
IUPAC Name1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid
SMILESCn1c(=O)[nH]c(=O)c2ccc(C(=O)O)nc21
InChIInChI=1S/C9H7N3O4/c1-12-6-4(7(13)11-9(12)16)2-3-5(10-6)8(14)15/h2-3H,1H3,(H,14,15)(H,11,13,16)
InChIKeyCAOKZFGLLFQDNW-UHFFFAOYSA-N
XLogP-0.68
TPSA105.05 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.17
LogP ≤ 5-0.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid?
The IUPAC name of 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid (CID 24697601) is 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid?
The canonical SMILES for 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid is Cn1c(=O)[nH]c(=O)c2ccc(C(=O)O)nc21.
What is the InChIKey of 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid?
The InChIKey is CAOKZFGLLFQDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O4/c1-12-6-4(7(13)11-9(12)16)2-3-5(10-6)8(14)15/h2-3H,1H3,(H,14,15)(H,11,13,16).
What are the key properties of 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid?
1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid has a molecular weight of 221.17 g/mol, XLogP of -0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 24697601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).