C23H26ClN4O4S+ — CID 2470329
2-[(5Z)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethylazanium (PubChem CID 2470329) has the molecular formula C23H26ClN4O4S+ and a molecular weight of 490.01 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethylazanium.
| Compound Name | 2-[(5Z)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 2470329 |
| Molecular Formula | C23H26ClN4O4S+ |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[(5Z)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN1C(=O)/C(=C/c2ccc(Cl)c([N+](=O)[O-])c2)S/C1=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25ClN4O4S/c1-4-26(5-2)12-13-27-22(29)21(15-16-6-11-19(24)20(14-16)28(30)31)33-23(27)25-17-7-9-18(32-3)10-8-17/h6-11,14-15H,4-5,12-13H2,1-3H3/p+1/b21-15-,25-23+ |
| InChIKey | GRWCSHLMMBJFNK-VLYZUMCXSA-O |
| XLogP | 3.79 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|