C10H12N2O5 — CID 24704137
3-hydroxy-2-[(2-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid (PubChem CID 24704137) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[(2-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 24704137 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-hydroxy-2-[(2-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)c1ccc[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C10H12N2O5/c1-5(13)7(10(16)17)12-9(15)6-3-2-4-11-8(6)14/h2-5,7,13H,1H3,(H,11,14)(H,12,15)(H,16,17) |
| InChIKey | IPHCJNSQOKKUIS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |