C8H11NO3S — CID 24704964
2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylpropanoic acid (PubChem CID 24704964) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 24704964 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylpropanoic acid |
| SMILES | C#CCNC(=O)CSC(C)C(=O)O |
| InChI | InChI=1S/C8H11NO3S/c1-3-4-9-7(10)5-13-6(2)8(11)12/h1,6H,4-5H2,2H3,(H,9,10)(H,11,12) |
| InChIKey | VYBLWDHKDGGFSH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|