C9H13NO3S — CID 105353372
2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylbutanoic acid (PubChem CID 105353372) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylbutanoic acid.
| Compound Name | 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105353372 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfanylbutanoic acid |
| SMILES | C#CCNC(=O)CSC(CC)C(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-3-5-10-8(11)6-14-7(4-2)9(12)13/h1,7H,4-6H2,2H3,(H,10,11)(H,12,13) |
| InChIKey | CXGQTBUEQVLDQS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|