C10H18N2O4S — CID 105352987
2-[2-(2-acetamidoethylamino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 105352987) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-[2-(2-acetamidoethylamino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-[2-(2-acetamidoethylamino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105352987 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[2-(2-acetamidoethylamino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | CCC(SCC(=O)NCCNC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O4S/c1-3-8(10(15)16)17-6-9(14)12-5-4-11-7(2)13/h8H,3-6H2,1-2H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | FXFIBNQVCCWJQN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|