C10H16N2O3 — CID 79270508
2-[[[2-(prop-2-ynylamino)acetyl]amino]methyl]butanoic acid (PubChem CID 79270508) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[[[2-(prop-2-ynylamino)acetyl]amino]methyl]butanoic acid.
| Compound Name | 2-[[[2-(prop-2-ynylamino)acetyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 79270508 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[[[2-(prop-2-ynylamino)acetyl]amino]methyl]butanoic acid |
| SMILES | C#CCNCC(=O)NCC(CC)C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-3-5-11-7-9(13)12-6-8(4-2)10(14)15/h1,8,11H,4-7H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | ADEGTUICMNWEQY-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|