C7H13N3O — CID 79287786
N-(2-aminoethyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79287786) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79287786 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-(2-aminoethyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)NCCN |
| InChI | InChI=1S/C7H13N3O/c1-2-4-9-6-7(11)10-5-3-8/h1,9H,3-6,8H2,(H,10,11) |
| InChIKey | XDPNDHSVSWUJTB-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|