C13H14F2N2O — CID 79271793
N-[2-(3,5-difluorophenyl)ethyl]-2-(prop-2-ynylamino)acetamide (PubChem CID 79271793) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79271793 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H14F2N2O/c1-2-4-16-9-13(18)17-5-3-10-6-11(14)8-12(15)7-10/h1,6-8,16H,3-5,9H2,(H,17,18) |
| InChIKey | RBQPCIGGCAYVFW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|