C15H21F2N3O — CID 62832012
2-(1,4-diazepan-1-yl)-N-[2-(3,5-difluorophenyl)ethyl]acetamide (PubChem CID 62832012) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[2-(3,5-difluorophenyl)ethyl]acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[2-(3,5-difluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 62832012 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[2-(3,5-difluorophenyl)ethyl]acetamide |
| SMILES | O=C(CN1CCCNCC1)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H21F2N3O/c16-13-8-12(9-14(17)10-13)2-4-19-15(21)11-20-6-1-3-18-5-7-20/h8-10,18H,1-7,11H2,(H,19,21) |
| InChIKey | YMVMQJSBGWMNOP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |