C14H22N4O — CID 55123139
2-(1,4-diazepan-1-yl)-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 55123139) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 55123139 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)NCCc1ccncc1 |
| InChI | InChI=1S/C14H22N4O/c19-14(12-18-10-1-5-15-9-11-18)17-8-4-13-2-6-16-7-3-13/h2-3,6-7,15H,1,4-5,8-12H2,(H,17,19) |
| InChIKey | FWGOWLRSOOZTSJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |