C12H15F2NO2 — CID 62295850
N-[2-(3,5-difluorophenyl)ethyl]-2-ethoxyacetamide (PubChem CID 62295850) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-2-ethoxyacetamide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 62295850 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-2-17-8-12(16)15-4-3-9-5-10(13)7-11(14)6-9/h5-7H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | UWLSAEIHWVNIMS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |