C10H9F3N2OS — CID 24705607
N-(2-carbamothioylphenyl)-3,3,3-trifluoropropanamide (PubChem CID 24705607) has the molecular formula C10H9F3N2OS and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(2-carbamothioylphenyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 24705607 |
| Molecular Formula | C10H9F3N2OS |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-(2-carbamothioylphenyl)-3,3,3-trifluoropropanamide |
| SMILES | NC(=S)c1ccccc1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2OS/c11-10(12,13)5-8(16)15-7-4-2-1-3-6(7)9(14)17/h1-4H,5H2,(H2,14,17)(H,15,16) |
| InChIKey | SCZRGHNVYPYJPR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|