C15H23N3OS — CID 63981248
N-(2-carbamothioylphenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide (PubChem CID 63981248) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide.
| Compound Name | N-(2-carbamothioylphenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 63981248 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(2-carbamothioylphenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide |
| SMILES | CCC(C)(C)N(C)CC(=O)Nc1ccccc1C(N)=S |
| InChI | InChI=1S/C15H23N3OS/c1-5-15(2,3)18(4)10-13(19)17-12-9-7-6-8-11(12)14(16)20/h6-9H,5,10H2,1-4H3,(H2,16,20)(H,17,19) |
| InChIKey | RDGVUNFZYFUZMC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|