C14H14N2OS2 — CID 24708596
N-(3-amino-3-sulfanylidenepropyl)-N-phenylthiophene-2-carboxamide (PubChem CID 24708596) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-phenylthiophene-2-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24708596 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-phenylthiophene-2-carboxamide |
| SMILES | NC(=S)CCN(C(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2OS2/c15-13(18)8-9-16(11-5-2-1-3-6-11)14(17)12-7-4-10-19-12/h1-7,10H,8-9H2,(H2,15,18) |
| InChIKey | IFUNMAWEYDNGSG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|