C10H12F2N2O — CID 24709480
N-(3-aminopropyl)-2,6-difluorobenzamide (PubChem CID 24709480) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,6-difluorobenzamide.
| Compound Name | N-(3-aminopropyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 24709480 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(3-aminopropyl)-2,6-difluorobenzamide |
| SMILES | NCCCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2O/c11-7-3-1-4-8(12)9(7)10(15)14-6-2-5-13/h1,3-4H,2,5-6,13H2,(H,14,15) |
| InChIKey | LKUBJJKNQULKHB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|