C17H20N2O5S — CID 2471
View drug profile → bumetanide3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 2471) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 2471 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | MAEIEVLCKWDQJH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|