C24H26ClN2O3+ — CID 2471252
benzyl-[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]-(2-hydroxyethyl)azanium (PubChem CID 2471252) has the molecular formula C24H26ClN2O3+ and a molecular weight of 425.94 g/mol. Its IUPAC name is benzyl-[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]-(2-hydroxyethyl)azanium.
| Compound Name | benzyl-[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2471252 |
| Molecular Formula | C24H26ClN2O3+ |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | benzyl-[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]-(2-hydroxyethyl)azanium |
| SMILES | COc1ccc(NC(=O)[C@@H](c2ccccc2)[NH+](CCO)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H25ClN2O3/c1-30-22-13-12-20(16-21(22)25)26-24(29)23(19-10-6-3-7-11-19)27(14-15-28)17-18-8-4-2-5-9-18/h2-13,16,23,28H,14-15,17H2,1H3,(H,26,29)/p+1/t23-/m1/s1 |
| InChIKey | DDFYAVYBHVYDFS-HSZRJFAPSA-O |
| XLogP | 3.11 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |