C18H24FNO3 — CID 24713097
1-[(2-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 24713097) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 24713097 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1ccccc1F)CC1CCCO1 |
| InChI | InChI=1S/C18H24FNO3/c1-2-9-22-14-16(21)12-20(13-17-7-5-10-23-17)11-15-6-3-4-8-18(15)19/h1,3-4,6,8,16-17,21H,5,7,9-14H2 |
| InChIKey | GGLHJPQXEYFCQE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|