C14H16Cl2N2O2S — CID 24714242
N-[[2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 24714242) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is N-[[2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 24714242 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-[[2-[(2,5-dichlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1csc(COc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c1-19-5-4-17-7-11-9-21-14(18-11)8-20-13-6-10(15)2-3-12(13)16/h2-3,6,9,17H,4-5,7-8H2,1H3 |
| InChIKey | SIMJHLZQPHLRRS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|