C15H18ClN3O2 — CID 24714583
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol (PubChem CID 24714583) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 24714583 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CNCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-2-3-4-13(20)9-17-10-14-18-15(19-21-14)11-5-7-12(16)8-6-11/h2,5-8,13,17,20H,1,3-4,9-10H2 |
| InChIKey | LRGNUZWQAAOHHY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|