C15H18N4O4 — CID 93184163
(2S)-1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol (PubChem CID 93184163) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is (2S)-1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93184163 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2S)-1-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CNCc1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C15H18N4O4/c1-2-3-4-13(20)9-16-10-14-17-15(18-23-14)11-5-7-12(8-6-11)19(21)22/h2,5-8,13,16,20H,1,3-4,9-10H2/t13-/m0/s1 |
| InChIKey | JBZYYHAWKVUSTE-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|