C18H26N4O — CID 24714737
N',N'-dimethyl-N-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 24714737) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 24714737 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N',N'-dimethyl-N-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1c(-c2ccccc2)noc1N1CCCC1 |
| InChI | InChI=1S/C18H26N4O/c1-21(2)13-10-19-14-16-17(15-8-4-3-5-9-15)20-23-18(16)22-11-6-7-12-22/h3-5,8-9,19H,6-7,10-14H2,1-2H3 |
| InChIKey | IBJDREZSQOGWLO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|