C25H30FN5OS — CID 42843750
1-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)-1-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]thiourea (PubChem CID 42843750) has the molecular formula C25H30FN5OS and a molecular weight of 467.61 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)-1-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)-1-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 42843750 |
| Molecular Formula | C25H30FN5OS |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)-1-[(3-phenyl-5-pyrrolidin-1-yl-1,2-oxazol-4-yl)methyl]thiourea |
| SMILES | CN(C)CCN(Cc1c(-c2ccccc2)noc1N1CCCC1)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H30FN5OS/c1-29(2)16-17-31(25(33)27-21-12-10-20(26)11-13-21)18-22-23(19-8-4-3-5-9-19)28-32-24(22)30-14-6-7-15-30/h3-5,8-13H,6-7,14-18H2,1-2H3,(H,27,33) |
| InChIKey | DWQJWBNJNCCPME-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|