C26H31FN4O2S — CID 46027968
3-(4-fluorophenyl)-1-(2-methoxyethyl)-1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]thiourea (PubChem CID 46027968) has the molecular formula C26H31FN4O2S and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(2-methoxyethyl)-1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-(2-methoxyethyl)-1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 46027968 |
| Molecular Formula | C26H31FN4O2S |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(2-methoxyethyl)-1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl]thiourea |
| SMILES | COCCN(Cc1c(-c2ccccc2)noc1N1CCCCC1C)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H31FN4O2S/c1-19-8-6-7-15-31(19)25-23(24(29-33-25)20-9-4-3-5-10-20)18-30(16-17-32-2)26(34)28-22-13-11-21(27)12-14-22/h3-5,9-14,19H,6-8,15-18H2,1-2H3,(H,28,34) |
| InChIKey | IMESLMCNUUBFCZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|